ChemNet > CAS > 4923-87-9 5-Bromobenzo[b]thiophene
4923-87-9;133150-64-8 5-Bromobenzo[b]thiophene
Ονομασ?α του προ??ντο? |
5-Bromobenzo[b]thiophene |
Αγγλικ? ?νομα |
5-Bromobenzo[b]thiophene; 5-Bromothianaphthene; 5-bromo-1-benzothiophene; 5-Bromobenzo[b]thioophene; 5-Bromobenzothiophene; ; BUTTPARK 98\04-80; Benzo[c]thiophene, 5-bromo- |
MF |
C8H5BrS |
Μοριακ? β?ρο? |
213.0943 |
InChI |
InChI=1/C8H5BrS/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H |
CAS ΟΧΙ |
4923-87-9;133150-64-8 |
Μοριακ? δομ? |
|
Πυκν?τητα |
1.649g/cm3 |
Σημε?ο τ?ξη? |
46℃ |
Σημε?ο βρασμο? |
284.7°C at 760 mmHg |
Δε?κτη? δι?θλαση? |
1.704 |
Σημε?ο αν?φλεξη? |
126°C |
Π?εση ατμ?ν |
0.00503mmHg at 25°C |
Σ?μβολα επικινδυν?τητα? |
Xi:Irritant;
|
Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|